5-[(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-1-propylpyridine-3-carbonitrile structure
|
Common Name | 5-[(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-1-propylpyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 7064-29-1 | Molecular Weight | 500.72000 | |
| Density | 1.24g/cm3 | Boiling Point | 508.7ºC at 760mmHg | |
| Molecular Formula | C26H36N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
| Name | 5-[(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 508.7ºC at 760mmHg |
| Molecular Formula | C26H36N4O2S2 |
| Molecular Weight | 500.72000 |
| Flash Point | 261.5ºC |
| Exact Mass | 500.22800 |
| PSA | 126.73000 |
| LogP | 5.45908 |
| Index of Refraction | 1.621 |
| InChIKey | HAYGQPDJEVXBJL-UHFFFAOYSA-N |
| SMILES | CCCCCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CCC)c2N2CCCC(C)C2)SC1=S |
|
~%
5-[(3-hexyl-4-o... CAS#:7064-29-1 |
| Literature: Murray,B.G.; Turner,A.F. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1338 - 1339 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Decahydro-3,3-dimethyl-pyrrolo<1,2-b>-1,2-benzisoxazol-9-on |
| 3,3-dimethyl-octahydro-benzo[d]pyrrolo[1,2-b]isoxazol-9-one |