6-(4-benzylpiperazin-1-yl)-1-butyl-4-methyl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile structure
|
Common Name | 6-(4-benzylpiperazin-1-yl)-1-butyl-4-methyl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 7064-89-3 | Molecular Weight | 577.80400 | |
| Density | 1.28g/cm3 | Boiling Point | 582.1ºC at 760mmHg | |
| Molecular Formula | C31H39N5O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.8ºC | |
| Name | 6-(4-benzylpiperazin-1-yl)-1-butyl-4-methyl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 582.1ºC at 760mmHg |
| Molecular Formula | C31H39N5O2S2 |
| Molecular Weight | 577.80400 |
| Flash Point | 305.8ºC |
| Exact Mass | 577.25500 |
| PSA | 129.97000 |
| LogP | 5.48288 |
| Index of Refraction | 1.656 |
| InChIKey | HIWBAWBTFGCTKQ-UHFFFAOYSA-N |
| SMILES | CCCCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CCCC)c2N2CCN(Cc3ccccc3)CC2)SC1=S |
|
~%
6-(4-benzylpipe... CAS#:7064-89-3 |
| Literature: Blanchard,E.P.; Cairncross,A. Journal of the American Chemical Society, 1966 , vol. 88, p. 487 - 495 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Methyl-3-cyano-3-<2-hydroxy-1,3-dichlor-1,1,3,3-tetrafluor-propyl-2>-cyclobuten-1 |