N-[4-ethoxy-3,5-di(propan-2-yl)phenyl]-3-nitrobenzamide structure
|
Common Name | N-[4-ethoxy-3,5-di(propan-2-yl)phenyl]-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 7066-61-7 | Molecular Weight | 370.44200 | |
| Density | 1.154g/cm3 | Boiling Point | 440.6ºC at 760 mmHg | |
| Molecular Formula | C21H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | N-[4-ethoxy-3,5-di(propan-2-yl)phenyl]-3-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 440.6ºC at 760 mmHg |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.44200 |
| Flash Point | 220.3ºC |
| Exact Mass | 370.18900 |
| PSA | 87.64000 |
| LogP | 6.39980 |
| Index of Refraction | 1.581 |
| InChIKey | GMPUCGVNAGLHEU-UHFFFAOYSA-N |
| SMILES | CCOc1c(C(C)C)cc(NC(=O)c2cccc([N+](=O)[O-])c2)cc1C(C)C |
|
~%
N-[4-ethoxy-3,5... CAS#:7066-61-7 |
| Literature: Eli Lilly and Co. Patent: US3225096 , 1965 ; Chem.Abstr., 1966 , vol. 64, # 9643 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(3,4-Dichlorphenacyl)cyclopropylamin |
| N-(4-ethoxy-3,5-dipropan-2-yl-phenyl)-3-nitro-benzamide |