1,3,5-Trimethyl-2-(trichloromethyl)benzene structure
|
Common Name | 1,3,5-Trimethyl-2-(trichloromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 707-74-4 | Molecular Weight | 237.55300 | |
| Density | 1.253g/cm3 | Boiling Point | 276.4ºC at 760 mmHg | |
| Molecular Formula | C10H11Cl3 | Melting Point | 16-18ºC | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | 1,3,5-Trimethyl-2-(trichloromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 276.4ºC at 760 mmHg |
| Melting Point | 16-18ºC |
| Molecular Formula | C10H11Cl3 |
| Molecular Weight | 237.55300 |
| Flash Point | 182ºC |
| Exact Mass | 235.99300 |
| LogP | 4.43850 |
| Index of Refraction | 1.543 |
| InChIKey | KJYSFXXGQXIPIG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(Cl)(Cl)Cl)c(C)c1 |
| HS Code | 2903999090 |
|---|
|
~52%
1,3,5-Trimethyl... CAS#:707-74-4 |
| Literature: Collins, Michael J.; Gready, Jill E.; Sternhell, Sever; Tansey, Charles W. Australian Journal of Chemistry, 1990 , vol. 43, p. 1547 - 1557 |
|
~%
1,3,5-Trimethyl... CAS#:707-74-4 |
| Literature: WO2005/12219 A1, ; Page/Page column 9; 10 ; |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-trichloromethyl-2,4,6-trimethylbenzene |
| mesitotrichloride |
| trichloromethylmesitylene |
| mesityltrichloromethane |
| 2,4,6-trimethylbenzotrichloride |