6-(chlorosulphonyl)-2-hydroxy-1-naphthoic acid structure
|
Common Name | 6-(chlorosulphonyl)-2-hydroxy-1-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 70714-67-9 | Molecular Weight | 286.68800 | |
| Density | 1.674g/cm3 | Boiling Point | 533.7ºC at 760 mmHg | |
| Molecular Formula | C11H7ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.6ºC | |
| Name | 6-chlorosulfonyl-2-hydroxynaphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.674g/cm3 |
|---|---|
| Boiling Point | 533.7ºC at 760 mmHg |
| Molecular Formula | C11H7ClO5S |
| Molecular Weight | 286.68800 |
| Flash Point | 276.6ºC |
| Exact Mass | 285.97000 |
| PSA | 100.05000 |
| LogP | 3.25190 |
| Index of Refraction | 1.694 |
| InChIKey | YTGWIRDQNSSAJX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(O)ccc2cc(S(=O)(=O)Cl)ccc12 |
|
~%
6-(chlorosulpho... CAS#:70714-67-9 |
| Literature: Bayer and Co. Patent: DE278091 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 179 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| EINECS 274-799-1 |
| 6-Chlorosulfonyl-2-hydroxy-naphthalene-1 |
| 6-chlorosulfonyl-2-hydroxy-[1]naphthoic acid |
| 6-(Chlorosulphonyl)-2-hydroxy-1-naphthoic acid |
| 6-Chlorsulfonyl-2-hydroxy-[1]naphthoesaeure |