2-tert-butylphenol,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol structure
|
Common Name | 2-tert-butylphenol,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 70715-08-1 | Molecular Weight | 471.02800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H35ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-tert-butylphenol,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H35ClO4 |
|---|---|
| Molecular Weight | 471.02800 |
| Exact Mass | 470.22200 |
| PSA | 73.22000 |
| LogP | 6.73740 |
| InChIKey | GICCATZNJKDZLR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccccc1O.CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.ClCC1CO1 |
| Phenol,2-(1,1-dimethylethyl)-,polymer with 2-(chloromethyl)oxirane and 4,4'-(1-methylethylidene)bis(phenol) |
| Phenol,2-(1,1-dimethylethyl)-,polymer with (chloromethyl)oxirane and 4,4'-(1-methylethylidene)bis(phenol) |
| 4,4'-(1-Methylethylidene)bisphenol,2-(1,1-dimethylethyl) phenol,(chloromethyl)oxirane polymer |