N-[2-[methyl(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide structure
|
Common Name | N-[2-[methyl(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 70717-53-2 | Molecular Weight | 241.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-[methyl(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H23N3O2 |
|---|---|
| Molecular Weight | 241.33000 |
| Exact Mass | 241.17900 |
| PSA | 56.14000 |
| LogP | 0.84340 |
| InChIKey | RJXCMJMPMSWLAN-UHFFFAOYSA-N |
| SMILES | CC(C)N(C)CCNC(=O)CN1CCCC1=O |
|
~59%
N-[2-[methyl(pr... CAS#:70717-53-2 |
| Literature: Butler; Nordin; L'Italien; Zweisler; Poschel; Marriott Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 684 - 691 |
|
~%
N-[2-[methyl(pr... CAS#:70717-53-2 |
| Literature: Parke, Davis and Company Patent: US4145347 A1, 1979 ; |
|
~%
N-[2-[methyl(pr... CAS#:70717-53-2 |
| Literature: Butler; Nordin; L'Italien; Zweisler; Poschel; Marriott Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 684 - 691 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-[2-[methyl(1-methylethyl)amino]ethyl]-2-oxo-1-pyrrolidine acetamide |
| 1-Pyrrolidineacetamide,N-[2-[methyl(1-methylethyl)amino]ethyl]-2-oxo |