Leurubicin
Modify Date: 2025-08-25 12:18:09
Leurubicin structure
|
Common Name | Leurubicin | ||
|---|---|---|---|---|
| CAS Number | 70774-25-3 | Molecular Weight | 656.67700 | |
| Density | 1.49g/cm3 | Boiling Point | 916.2ºC at 760 mmHg | |
| Molecular Formula | C33H40N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 507.9ºC | |
| Name | Leurubicin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 916.2ºC at 760 mmHg |
| Molecular Formula | C33H40N2O12 |
| Molecular Weight | 656.67700 |
| Flash Point | 507.9ºC |
| Exact Mass | 656.25800 |
| PSA | 235.17000 |
| LogP | 1.62340 |
| Index of Refraction | 1.666 |
| InChIKey | HROXIDVVXKDCBD-ZUWKMVCBSA-N |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(=O)CO)CC3OC1CC(NC(=O)C(N)CC(C)C)C(O)C(C)O1 |
|
~%
Leurubicin CAS#:70774-25-3 |
| Literature: Chung, Da-Eun; Kratz, Felix Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 19 p. 5157 - 5163 |
|
~%
Leurubicin CAS#:70774-25-3 |
| Literature: Garsky; Lumma; Feng; Wai; Ramjit; Sardana; Oliff; Jones; DeFeo-Jones; Freidinger Journal of Medicinal Chemistry, 2001 , vol. 44, # 24 p. 4216 - 4224 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(L-Leucyl)doxorubicin |
| N-leucyldoxorubicin |
| leucine-doxorubicin |
| L-Leucyldoxorubicin |