4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride structure
|
Common Name | 4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 70823-04-0 | Molecular Weight | 260.78000 | |
| Density | 1.157g/cm3 | Boiling Point | 324.1ºC at 760 mmHg | |
| Molecular Formula | C12H17ClO2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 149.8ºC | |
| Name | 4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 324.1ºC at 760 mmHg |
| Molecular Formula | C12H17ClO2S |
| Molecular Weight | 260.78000 |
| Flash Point | 149.8ºC |
| Exact Mass | 260.06400 |
| PSA | 42.52000 |
| LogP | 4.60920 |
| Index of Refraction | 1.516 |
| InChIKey | HZWYWYSLHBTTRW-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)Cl |
| HS Code | 2904909090 |
|---|
|
~%
4-tert-butyl-2,... CAS#:70823-04-0 |
| Literature: Sviridova; Laba; Vasil'ev; Litvinov Russian Chemical Bulletin, 2001 , vol. 50, # 3 p. 563 - 565 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-tert-butyl-2,6-dimethylbenzene-1-sulfonyl chloride |
| 4-t-butyl-2,6-dimethylbenzenesulphonyl chloride |
| 2,6-dimethyl-4-tert-butylbenzenesulfonyl chloride |