Cyclo(D-alanyl-L-seryl-N,O-dimethyl-L-tyrosyl-L-alanyl-N-methyl-L-tyrosyl-3-hydroxy-N,O-dimethyl-L-tyrosyl),cyclic (54®63)-ether structure
|
Common Name | Cyclo(D-alanyl-L-seryl-N,O-dimethyl-L-tyrosyl-L-alanyl-N-methyl-L-tyrosyl-3-hydroxy-N,O-dimethyl-L-tyrosyl),cyclic (54®63)-ether | ||
|---|---|---|---|---|
| CAS Number | 70840-66-3 | Molecular Weight | 786.87000 | |
| Density | 1.191g/cm3 | Boiling Point | 1116.3ºC at 760 mmHg | |
| Molecular Formula | C41H50N6O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 628.9ºC | |
| Name | 6-O-methylbouvardin |
|---|
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 1116.3ºC at 760 mmHg |
| Molecular Formula | C41H50N6O10 |
| Molecular Weight | 786.87000 |
| Flash Point | 628.9ºC |
| Exact Mass | 786.35900 |
| PSA | 196.15000 |
| LogP | 2.13710 |
| Index of Refraction | 1.54 |
| InChIKey | BVLKHUDGMCRYQG-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2C(=O)NC(C)C(=O)N(C)C3C(=O)N(C)C(Cc4ccc(OC)c(c4)Oc4ccc(cc4)C3O)C(=O)NC(C)C(=O)NC(C)C(=O)N2C)cc1 |
|
~%
Cyclo(D-alanyl-... CAS#:70840-66-3 |
| Literature: Bates,R.B.; Cole,J.R.; Hoffmann,J.J. Journal of the American Chemical Society, 1983 , vol. 105, p. 1343 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |