methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-2-methyl-propanoate structure
|
Common Name | methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-2-methyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 70842-02-3 | Molecular Weight | 338.71000 | |
| Density | 1.374g/cm3 | Boiling Point | 367.2ºC at 760 mmHg | |
| Molecular Formula | C13H14ClF3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.9ºC | |
| Name | methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 367.2ºC at 760 mmHg |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71000 |
| Flash Point | 175.9ºC |
| Exact Mass | 338.06500 |
| PSA | 70.92000 |
| LogP | 3.83640 |
| Index of Refraction | 1.514 |
| InChIKey | SPEYUSRXPOAHEC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C)NC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
|
~90%
methyl 2-[[4-ch... CAS#:70842-02-3 |
| Literature: Link; Stohler European Journal of Medicinal Chemistry, 1984 , vol. 19, # 3 p. 261 - 265 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Propanoic acid,2-((((4-chloro-3-(trifluoromethyl)phenyl)amino)carbonyl)amino)-2-methyl-,methyl ester |
| N-[(3-trifluoromethyl-4-chlorophenyl)-carbamoyl]-2-methylalanine methyl ester |
| Alanine,N-[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]-2-methyl-,methyl ester |
| METHYL 2-[[4-CHLORO-3-(TRIFLUOROMETHYL)PHENYL]CARBAMOYLAMINO]-2-METHYL-PROPANOATE |