2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitro-benzene
2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitro-benzene structure
|
Common Name | 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 70862-29-2 | Molecular Weight | 393.22200 | |
| Density | 1.708g/cm3 | Boiling Point | 508.3ºC at 760 mmHg | |
| Molecular Formula | C13H7N5O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.708g/cm3 |
|---|---|
| Boiling Point | 508.3ºC at 760 mmHg |
| Molecular Formula | C13H7N5O10 |
| Molecular Weight | 393.22200 |
| Flash Point | 241.6ºC |
| Exact Mass | 393.01900 |
| PSA | 229.10000 |
| LogP | 5.81900 |
| Index of Refraction | 1.694 |
| InChIKey | QFHXXZWSRJRXBK-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(2,4-dinitrop... CAS#:70862-29-2 |
| Literature: Stearns; Adams Journal of the American Chemical Society, 1930 , vol. 52, p. 2070,2073, 2074 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Methyl-2,4,6,2',4'-pentanitro-biphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: Molecular formula of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene is C13H7N5O10. |
| Q: What is the boiling point of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: Boiling point of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene is 508.3ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: Polar surface area (PSA) of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene is 229.10000. |
| Q: What English synonyms does 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene have? |
| A: English synonyms of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene: 3-Methyl-2,4,6,2',4'-pentanitro-biphenyl. |
| Q: What is the Chinese name of 70862-29-2? |
| A: Chinese name of 70862-29-2 is 70862-29-2. |
| Q: What are the upstream materials of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: Related upstream materials(CAS) of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene: 5333-09-5;97-00-7. |
| Q: What is the molecular weight of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: Molecular weight of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene is 393.22200. |
| Q: What is the CAS number of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: CAS number of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene is 70862-29-2. |
| Q: What is the SMILES notation of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: SMILES notation of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene is Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1[N+](=O)[O-]. |
| Q: What is the LogP of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene? |
| A: LogP of 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene is 5.81900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |