o-nitrophenyl beta-d-cellobioside structure
|
Common Name | o-nitrophenyl beta-d-cellobioside | ||
|---|---|---|---|---|
| CAS Number | 70867-33-3 | Molecular Weight | 463.39000 | |
| Density | 1.7g/cm3 | Boiling Point | 787.5ºC at 760 mmHg | |
| Molecular Formula | C18H25NO13 | Melting Point | 215-216ºC | |
| MSDS | USA | Flash Point | 430.1ºC | |
| Name | 2-[4,5-dihydroxy-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 787.5ºC at 760 mmHg |
| Melting Point | 215-216ºC |
| Molecular Formula | C18H25NO13 |
| Molecular Weight | 463.39000 |
| Flash Point | 430.1ºC |
| Exact Mass | 463.13300 |
| PSA | 224.35000 |
| Index of Refraction | 1.67 |
| InChIKey | CYCLRDYAFVRUDE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O |
| Storage condition | −20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| 2-Nitrophenyl |A-D-cellobioside |