Phosphonic difluoride, [4-(1-methylethyl)phenyl]
Modify Date: 2026-07-23 20:17:20
![Phosphonic difluoride, [4-(1-methylethyl)phenyl] Structure](https://www.chemsrc.com/extcaspic/496/709-65-9.png)
Phosphonic difluoride, [4-(1-methylethyl)phenyl] structure
|
Common Name | Phosphonic difluoride, [4-(1-methylethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 709-65-9 | Molecular Weight | 204.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11F2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phosphonic difluoride, [4-(1-methylethyl)phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11F2OP |
|---|---|
| Molecular Weight | 204.15 |
| InChIKey | YLLJDCMCGGLSOC-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(P(=O)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Phosphonic difluoride, [4-(1-methylethyl)phenyl]? |
| A: SMILES notation of Phosphonic difluoride, [4-(1-methylethyl)phenyl] is CC(C)c1ccc(P(=O)(F)F)cc1. |
| Q: What is the English name of Phosphonic difluoride, [4-(1-methylethyl)phenyl]? |
| A: The English name of Phosphonic difluoride, [4-(1-methylethyl)phenyl] is Phosphonic difluoride, [4-(1-methylethyl)phenyl]. |
| Q: What is the Chinese name of 709-65-9? |
| A: Chinese name of 709-65-9 is 709-65-9. |
| Q: What is the molecular formula of Phosphonic difluoride, [4-(1-methylethyl)phenyl]? |
| A: Molecular formula of Phosphonic difluoride, [4-(1-methylethyl)phenyl] is C9H11F2OP. |
| Q: What is the molecular weight of Phosphonic difluoride, [4-(1-methylethyl)phenyl]? |
| A: Molecular weight of Phosphonic difluoride, [4-(1-methylethyl)phenyl] is 204.15. |
| Q: What is the InChIKey of Phosphonic difluoride, [4-(1-methylethyl)phenyl]? |
| A: InChIKey of Phosphonic difluoride, [4-(1-methylethyl)phenyl] is YLLJDCMCGGLSOC-UHFFFAOYSA-N. |
| Q: What is the CAS number of Phosphonic difluoride, [4-(1-methylethyl)phenyl]? |
| A: CAS number of Phosphonic difluoride, [4-(1-methylethyl)phenyl] is 709-65-9. |