Ethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate
Modify Date: 2025-09-27 20:34:49
Ethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate structure
|
Common Name | Ethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 70909-46-5 | Molecular Weight | 280.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O6 |
|---|---|
| Molecular Weight | 280.27300 |
| Exact Mass | 280.09500 |
| PSA | 78.90000 |
| LogP | 1.40880 |
| InChIKey | QKDCYXNBYBQHTI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc(OC)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
Ethyl 4-(3,4-di... CAS#:70909-46-5 |
| Literature: Haworth; Kelly Journal of the Chemical Society, 1937 , p. 1645,1649 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:109735-80-0| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoic acid ethyl ester |
| 4-(3,4-dimethoxy-phenyl)-2,4-dioxo-butyric acid ethyl ester |
| 4-(3,4-Dimethoxy-phenyl)-2,4-dioxo-buttersaeure-aethylester |