1,4-Bis((5-(dimethylamino)pentyl)amino)-9,10-anthracenedione structure
|
Common Name | 1,4-Bis((5-(dimethylamino)pentyl)amino)-9,10-anthracenedione | ||
|---|---|---|---|---|
| CAS Number | 70945-53-8 | Molecular Weight | 464.64300 | |
| Density | 1.131g/cm3 | Boiling Point | 637ºC at 760 mmHg | |
| Molecular Formula | C28H40N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339ºC | |
| Name | 1,4-bis[5-(dimethylamino)pentylamino]anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 637ºC at 760 mmHg |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.64300 |
| Flash Point | 339ºC |
| Exact Mass | 464.31500 |
| PSA | 64.68000 |
| LogP | 4.89560 |
| Index of Refraction | 1.602 |
| InChIKey | XUGBABFKYMUSTL-UHFFFAOYSA-N |
| SMILES | CN(C)CCCCCNc1ccc(NCCCCCN(C)C)c2c1C(=O)c1ccccc1C2=O |
|
~%
1,4-Bis((5-(dim... CAS#:70945-53-8 |
| Literature: Murdock,K.C. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 9 p. 1024 - 1030 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Bis((5-(dimethylamino)pentyl)amino)-9,10-anthracenedione |
| 9,10-Anthracenedione,1,4-bis((5-(dimethylamino)pentyl)amino) |