N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide
N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide structure
|
Common Name | N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 70945-99-2 | Molecular Weight | 251.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide (CAS number: 70945-99-2), molecular formula C14H21NO3, molecular weight 251.32100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21NO3 |
|---|---|
| Molecular Weight | 251.32100 |
| Exact Mass | 251.15200 |
| PSA | 38.77000 |
| LogP | 2.49420 |
| InChIKey | JFMYQVXEEZUMTL-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1c(C)ccc(OC)c1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:483-14-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N-diethyl 2,3-dimethoxy-6-methylbenzamide |
| N,N-diethyl-2,3-dimethoxy-6-methylbenzamide |
| 3,4-Dimethoxy-6-methyl-N,N-diethylbenzamid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: CAS number of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide is 70945-99-2. |
| Q: What is the polar surface area (PSA) of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: Polar surface area (PSA) of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide is 38.77000. |
| Q: What is the InChIKey of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: InChIKey of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide is JFMYQVXEEZUMTL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: Molecular formula of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide is C14H21NO3. |
| Q: What is the LogP of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: LogP of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide is 2.49420. |
| Q: What is the Chinese name of 70945-99-2? |
| A: Chinese name of 70945-99-2 is 70945-99-2. |
| Q: What is the SMILES notation of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: SMILES notation of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide is CCN(CC)C(=O)c1c(C)ccc(OC)c1OC. |
| Q: What English synonyms does N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide have? |
| A: English synonyms of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide: N,N-diethyl 2,3-dimethoxy-6-methylbenzamide, N,N-diethyl-2,3-dimethoxy-6-methylbenzamide, 3,4-Dimethoxy-6-methyl-N,N-diethylbenzamid. |
| Q: What is the English name of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: The English name of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide is N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide. |
| Q: What are the downstream products of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide? |
| A: Related downstream products(CAS) of N,N-diethyl-2,3-dimethoxy-6-methyl-benzamide: 483-14-7. |