5-acetyl-2-methylbenzenesulfonamide structure
|
Common Name | 5-acetyl-2-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 70958-70-2 | Molecular Weight | 213.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-acetyl-2-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11NO3S |
|---|---|
| Molecular Weight | 213.25400 |
| Exact Mass | 213.04600 |
| PSA | 85.61000 |
| LogP | 2.62610 |
| InChIKey | FOBJXKVZKYRFOO-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C)c(S(N)(=O)=O)c1 |
| HS Code | 2935009090 |
|---|
|
~%
5-acetyl-2-meth... CAS#:70958-70-2 |
| Literature: Fujikura; Miigata; Hashimoto; Imai; Takenaka Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 11 p. 4092 - 4101 |
|
~%
5-acetyl-2-meth... CAS#:70958-70-2 |
| Literature: Fujikura; Miigata; Hashimoto; Imai; Takenaka Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 11 p. 4092 - 4101 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 5-acetyl-2-methylbenzene-1-sulfonamide |
| 5-Acetyl-2-methylbenzolsulfonamid |
| Benzenesulfonamide,5-acetyl-2-methyl |