MeOSuc-Ala-Ala-Pro-Met-pNA structure
|
Common Name | MeOSuc-Ala-Ala-Pro-Met-pNA | ||
|---|---|---|---|---|
| CAS Number | 70967-91-8 | Molecular Weight | 622.69000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38N6O9S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of MeOSuc-Ala-Ala-Pro-Met-pNACathepsin G substrate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | methyl 4-[[1-[[1-[2-[[4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Cathepsin G substrate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Molecular Formula | C27H38N6O9S |
|---|---|
| Molecular Weight | 622.69000 |
| Exact Mass | 622.24200 |
| PSA | 234.13000 |
| LogP | 2.43160 |
| InChIKey | LUUQUDLEABXXQL-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(CCSC)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| N-Methoxysuccinyl-Ala-Ala-Pro-Met p-nitroanilide |
| MFCD00077134 |
| methyl 3-[(1-{[1-(2-{[3-(methylsulfanyl)-1-[(4-nitrophenyl)carbamoyl]propyl]carbamoyl}pyrrolidin-1-yl)-1-oxopropan-2-yl]carbamoyl}ethyl)carbamoyl]propanoate |
| MeOSuc-Ala-Ala-Pro-Met-pNA |