2-methylprop-1-ene,(3E)-penta-1,3-diene,styrene structure
|
Common Name | 2-methylprop-1-ene,(3E)-penta-1,3-diene,styrene | ||
|---|---|---|---|---|
| CAS Number | 70969-61-8 | Molecular Weight | 228.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylprop-1-ene,(3E)-penta-1,3-diene,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H24 |
|---|---|
| Molecular Weight | 228.37200 |
| Exact Mass | 228.18800 |
| LogP | 5.66050 |
| InChIKey | XHRLHAAPMSIVBX-YHVJRZKVSA-N |
| SMILES | C=C(C)C.C=CC=CC.C=Cc1ccccc1 |
| Benzene,ethenyl-,polymer with 2-methyl-1-propene and 1,3-pentadiene |
| Ethenylbenzene,2-methyl-1-propene,1,3-pentadiene polymer |