7,3',4'-Tri-O-methyleriodictyol structure
|
Common Name | 7,3',4'-Tri-O-methyleriodictyol | ||
|---|---|---|---|---|
| CAS Number | 70987-96-1 | Molecular Weight | 330.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 7,3',4'-Tri-O-methyleriodictyol7,3′,4′-Tri-O-methyleriodictyol is a flavonoid with an antimutagenic activity. 7,3′,4′-Tri-O-methyleriodictyol inhibits the furylfuramide-induced SOS response and has potency as bioantimutagens[1]. |
| Name | (-)-5-hydroxy-3',4',7-trimethoxyflavanone |
|---|---|
| Synonym | More Synonyms |
| Description | 7,3′,4′-Tri-O-methyleriodictyol is a flavonoid with an antimutagenic activity. 7,3′,4′-Tri-O-methyleriodictyol inhibits the furylfuramide-induced SOS response and has potency as bioantimutagens[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H18O6 |
|---|---|
| Molecular Weight | 330.33 |
| Exact Mass | 330.11000 |
| PSA | 74.22000 |
| LogP | 3.12450 |
| InChIKey | MRFOCZPULZWYTJ-HNNXBMFYSA-N |
| SMILES | COc1cc(O)c2c(c1)OC(c1ccc(OC)c(OC)c1)CC2=O |
| 5-hydroxy-7,3',4'-trimethoxyflavanone |
| (S)-2-(3,4-dimethoxy-phenyl)-5-hydroxy-7-methoxy-chroman-4-one |
| (S)-2-(3,4-Dimethoxy-phenyl)-5-hydroxy-7-methoxy-chroman-4-on |
| 7,3'-dimethoxy hesperetin |