3-(1,1,2,2,2-pentafluoroethyl)aniline
3-(1,1,2,2,2-pentafluoroethyl)aniline structure
|
Common Name | 3-(1,1,2,2,2-pentafluoroethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 710-74-7 | Molecular Weight | 211.13200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6F5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1,1,2,2,2-pentafluoroethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6F5N |
|---|---|
| Molecular Weight | 211.13200 |
| Exact Mass | 211.04200 |
| PSA | 26.02000 |
| LogP | 3.50410 |
| InChIKey | ABJVXSCTJMFIEM-UHFFFAOYSA-N |
| SMILES | Nc1cccc(C(F)(F)C(F)(F)F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(1,1,2,2,2-pe... CAS#:710-74-7 |
| Literature: Cragoe,E.J. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 896 - 912 |
|
~%
3-(1,1,2,2,2-pe... CAS#:710-74-7 |
| Literature: Cragoe,E.J. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 896 - 912 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| m-Pentafluorethyl-anilin |
| 3-Pentafluoraethyl-anilin |
| m-Pentafluoraethyl-anilin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: Molecular weight of 3-(1,1,2,2,2-pentafluoroethyl)aniline is 211.13200. |
| Q: What is the LogP of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: LogP of 3-(1,1,2,2,2-pentafluoroethyl)aniline is 3.50410. |
| Q: What is the SMILES notation of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: SMILES notation of 3-(1,1,2,2,2-pentafluoroethyl)aniline is Nc1cccc(C(F)(F)C(F)(F)F)c1. |
| Q: What is the polar surface area (PSA) of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: Polar surface area (PSA) of 3-(1,1,2,2,2-pentafluoroethyl)aniline is 26.02000. |
| Q: What is the molecular formula of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: Molecular formula of 3-(1,1,2,2,2-pentafluoroethyl)aniline is C8H6F5N. |
| Q: What is the Chinese name of 710-74-7? |
| A: Chinese name of 710-74-7 is 710-74-7. |
| Q: What is the English name of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: The English name of 3-(1,1,2,2,2-pentafluoroethyl)aniline is 3-(1,1,2,2,2-pentafluoroethyl)aniline. |
| Q: What is the InChIKey of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: InChIKey of 3-(1,1,2,2,2-pentafluoroethyl)aniline is ABJVXSCTJMFIEM-UHFFFAOYSA-N. |
| Q: What English synonyms does 3-(1,1,2,2,2-pentafluoroethyl)aniline have? |
| A: English synonyms of 3-(1,1,2,2,2-pentafluoroethyl)aniline: m-Pentafluorethyl-anilin, 3-Pentafluoraethyl-anilin, m-Pentafluoraethyl-anilin. |
| Q: What is the CAS number of 3-(1,1,2,2,2-pentafluoroethyl)aniline? |
| A: CAS number of 3-(1,1,2,2,2-pentafluoroethyl)aniline is 710-74-7. |