N-(2-chlorophenyl)-1-phenylmethanimine oxide structure
|
Common Name | N-(2-chlorophenyl)-1-phenylmethanimine oxide | ||
|---|---|---|---|---|
| CAS Number | 71013-75-7 | Molecular Weight | 231.67800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(2-chlorophenyl)-1-phenylmethanimine oxide, Chinese name: N-(2-氯苯基)-1-苯基甲animine氧化物, CAS number: 71013-75-7, molecular formula: C13H10ClNO, molecular weight: 231.67800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-chlorophenyl)-1-phenylmethanimine oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10ClNO |
|---|---|
| Molecular Weight | 231.67800 |
| Exact Mass | 231.04500 |
| PSA | 28.75000 |
| LogP | 4.12410 |
| InChIKey | MDAMGDYJLNAGFL-UHFFFAOYSA-N |
| SMILES | [O-][N+](=Cc1ccccc1)c1ccccc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(2-chlorophen... CAS#:71013-75-7 |
| Literature: Ram, Ram N.; Soni, Vineet Kumar Journal of Organic Chemistry, 2013 , vol. 78, # 23 p. 11935 - 11947 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-benzylidene-2-chlorobenzenamine oxide |
| Benzenamine,2-chloro-N-(phenylmethylene)-,N-oxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 71013-75-7? |
| A: Chinese name of 71013-75-7 is 71013-75-7. |
| Q: What is the polar surface area (PSA) of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: Polar surface area (PSA) of N-(2-chlorophenyl)-1-phenylmethanimine oxide is 28.75000. |
| Q: What is the CAS number of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: CAS number of N-(2-chlorophenyl)-1-phenylmethanimine oxide is 71013-75-7. |
| Q: What is the SMILES notation of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: SMILES notation of N-(2-chlorophenyl)-1-phenylmethanimine oxide is [O-][N+](=Cc1ccccc1)c1ccccc1Cl. |
| Q: What is the molecular formula of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: Molecular formula of N-(2-chlorophenyl)-1-phenylmethanimine oxide is C13H10ClNO. |
| Q: What is the molecular weight of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: Molecular weight of N-(2-chlorophenyl)-1-phenylmethanimine oxide is 231.67800. |
| Q: What is the English name of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: The English name of N-(2-chlorophenyl)-1-phenylmethanimine oxide is N-(2-chlorophenyl)-1-phenylmethanimine oxide. |
| Q: What is the InChIKey of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: InChIKey of N-(2-chlorophenyl)-1-phenylmethanimine oxide is MDAMGDYJLNAGFL-UHFFFAOYSA-N. |
| Q: What are the upstream materials of N-(2-chlorophenyl)-1-phenylmethanimine oxide? |
| A: Related upstream materials(CAS) of N-(2-chlorophenyl)-1-phenylmethanimine oxide: 10468-16-3;100-52-7. |
| Q: What English synonyms does N-(2-chlorophenyl)-1-phenylmethanimine oxide have? |
| A: English synonyms of N-(2-chlorophenyl)-1-phenylmethanimine oxide: N-benzylidene-2-chlorobenzenamine oxide, Benzenamine,2-chloro-N-(phenylmethylene)-,N-oxide. |