7-acetyl-1,3-dimethylpteridine-2,4-dione
7-acetyl-1,3-dimethylpteridine-2,4-dione structure
|
Common Name | 7-acetyl-1,3-dimethylpteridine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 71014-27-2 | Molecular Weight | 234.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 7-Acetyl-1,3-dimethylpteridine-2,4-dione (CAS number: 71014-27-2), molecular formula C10H10N4O3, molecular weight 234.21100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-acetyl-1,3-dimethylpteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N4O3 |
|---|---|
| Molecular Weight | 234.21100 |
| Exact Mass | 234.07500 |
| PSA | 86.85000 |
| InChIKey | LVUJULOKIXEKRW-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cnc2c(=O)n(C)c(=O)n(C)c2n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
7-acetyl-1,3-di... CAS#:71014-27-2 |
| Literature: Tada, Masaru; Ito, Takayori; Ohshima, Kaoru Journal of Heterocyclic Chemistry, 1986 , vol. 23, p. 1893 - 1896 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-acetyl-1,3-dimethyllumazine |
| 7-acetyl-1,3-dimethylpteridine-2,4(1H,3H)-dione |
| 7-Acetyl-1,3-dimethyllumazin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-acetyl-1,3-dimethylpteridine-2,4-dione? |
| A: Molecular formula of 7-acetyl-1,3-dimethylpteridine-2,4-dione is C10H10N4O3. |
| Q: What is the polar surface area (PSA) of 7-acetyl-1,3-dimethylpteridine-2,4-dione? |
| A: Polar surface area (PSA) of 7-acetyl-1,3-dimethylpteridine-2,4-dione is 86.85000. |
| Q: What is the English name of 7-acetyl-1,3-dimethylpteridine-2,4-dione? |
| A: The English name of 7-acetyl-1,3-dimethylpteridine-2,4-dione is 7-acetyl-1,3-dimethylpteridine-2,4-dione. |
| Q: What is the CAS number of 7-acetyl-1,3-dimethylpteridine-2,4-dione? |
| A: CAS number of 7-acetyl-1,3-dimethylpteridine-2,4-dione is 71014-27-2. |
| Q: What is the molecular weight of 7-acetyl-1,3-dimethylpteridine-2,4-dione? |
| A: Molecular weight of 7-acetyl-1,3-dimethylpteridine-2,4-dione is 234.21100. |
| Q: What English synonyms does 7-acetyl-1,3-dimethylpteridine-2,4-dione have? |
| A: English synonyms of 7-acetyl-1,3-dimethylpteridine-2,4-dione: 7-acetyl-1,3-dimethyllumazine, 7-acetyl-1,3-dimethylpteridine-2,4(1H,3H)-dione, 7-Acetyl-1,3-dimethyllumazin. |
| Q: What is the InChIKey of 7-acetyl-1,3-dimethylpteridine-2,4-dione? |
| A: InChIKey of 7-acetyl-1,3-dimethylpteridine-2,4-dione is LVUJULOKIXEKRW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 71014-27-2? |
| A: Chinese name of 71014-27-2 is 71014-27-2. |
| Q: What is the SMILES notation of 7-acetyl-1,3-dimethylpteridine-2,4-dione? |
| A: SMILES notation of 7-acetyl-1,3-dimethylpteridine-2,4-dione is CC(=O)c1cnc2c(=O)n(C)c(=O)n(C)c2n1. |