4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine
![4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine Structure](https://image.chemsrc.com/caspic/438/71017-29-3.png)
4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine structure
|
Common Name | 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine | ||
|---|---|---|---|---|
| CAS Number | 71017-29-3 | Molecular Weight | 402.53200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H30N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-[(2,6-Diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine, Chinese name: 4-[(2,6-二苯基-1,4-二氢-1,3,5-三嗪-4-基)环己基]吗啉, CAS number: 71017-29-3, molecular formula: C25H30N4O. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H30N4O |
|---|---|
| Molecular Weight | 402.53200 |
| Exact Mass | 402.24200 |
| PSA | 49.22000 |
| LogP | 2.98230 |
| InChIKey | LPRDGVUNAUYCGO-UHFFFAOYSA-N |
| SMILES | c1ccc(C2=NC(C3(N4CCOCC4)CCCCC3)N=C(c3ccccc3)N2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-[1-(2,6-diphe... CAS#:71017-29-3 |
| Literature: Citerio,L. et al. Tetrahedron, 1979 , vol. 35, p. 69 - 76 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(1-morpholin-4-yl-cyclohexyl)-4,6-diphenyl-1,2-dihydro-[1,3,5]triazine |
| 1,3,5-Triazine,1,2-dihydro-2-[1-(4-morpholinyl)cyclohexyl]-4,6-diphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 71017-29-3? |
| A: Chinese name of 71017-29-3 is 71017-29-3. |
| Q: What is the molecular formula of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: Molecular formula of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine is C25H30N4O. |
| Q: What English synonyms does 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine have? |
| A: English synonyms of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine: 2-(1-morpholin-4-yl-cyclohexyl)-4,6-diphenyl-1,2-dihydro-[1,3,5]triazine, 1,3,5-Triazine,1,2-dihydro-2-[1-(4-morpholinyl)cyclohexyl]-4,6-diphenyl. |
| Q: What is the polar surface area (PSA) of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: Polar surface area (PSA) of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine is 49.22000. |
| Q: What is the CAS number of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: CAS number of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine is 71017-29-3. |
| Q: What is the English name of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: The English name of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine is 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine. |
| Q: What is the LogP of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: LogP of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine is 2.98230. |
| Q: What is the molecular weight of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: Molecular weight of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine is 402.53200. |
| Q: What is the SMILES notation of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: SMILES notation of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine is c1ccc(C2=NC(C3(N4CCOCC4)CCCCC3)N=C(c3ccccc3)N2)cc1. |
| Q: What are the upstream materials of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine? |
| A: Related upstream materials(CAS) of 4-[1-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)cyclohexyl]morpholine: 40078-03-3. |