Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate
Modify Date: 2026-07-12 11:30:48
Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate structure
|
Common Name | Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate | ||
|---|---|---|---|---|
| CAS Number | 71030-40-5 | Molecular Weight | 334.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H34O3 |
|---|---|
| Molecular Weight | 334.5 |
| InChIKey | ZGQAWLCSJFHXDF-OASSHWDXSA-N |
| SMILES | CCCCCC(O)C=CC=CCC=CCC=CCCCC(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate? |
| A: Molecular formula of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate is C21H34O3. |
| Q: What is the Chinese name of 71030-40-5? |
| A: Chinese name of 71030-40-5 is 71030-40-5. |
| Q: What is the CAS number of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate? |
| A: CAS number of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate is 71030-40-5. |
| Q: What is the English name of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate? |
| A: The English name of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate is Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate. |
| Q: What is the InChIKey of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate? |
| A: InChIKey of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate is ZGQAWLCSJFHXDF-OASSHWDXSA-N. |
| Q: What is the SMILES notation of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate? |
| A: SMILES notation of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate is CCCCCC(O)C=CC=CCC=CCC=CCCCC(=O)OC. |
| Q: What is the molecular weight of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate? |
| A: Molecular weight of Methyl (5Z,8Z,11Z,13E)-15-hydroxy-5,8,11,13-eicosatetraenoate is 334.5. |