Benzoic acid, 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxy-
Modify Date: 2025-08-27 15:50:11
![Benzoic acid, 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxy- Structure](https://image.chemsrc.com/caspic/158/710311-03-8.png)
Benzoic acid, 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxy- structure
|
Common Name | Benzoic acid, 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 710311-03-8 | Molecular Weight | 317.29300 | |
| Density | 1.396g/cm3 | Boiling Point | 471.9ºC at 760 mmHg | |
| Molecular Formula | C16H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 471.9ºC at 760 mmHg |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.29300 |
| Flash Point | 239.2ºC |
| Exact Mass | 317.09000 |
| PSA | 105.09000 |
| LogP | 2.43290 |
| Index of Refraction | 1.651 |
| InChIKey | FGBCKOTUEAURJR-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(C(=O)O)c(O)c2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3,5-dimethoxybenzamido)-2-hydroxybenzoic acid |