3-Fluoro-5-nitrobenzeneboronic acid pinacol ester
3-Fluoro-5-nitrobenzeneboronic acid pinacol ester structure
|
Common Name | 3-Fluoro-5-nitrobenzeneboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 710348-94-0 | Molecular Weight | 267.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BFNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane (Chinese name: 2-(3-氟-5-硝基苯基)-4,4,5,5-四甲基-1,3,2-二氧硼杂环戊烷，CAS number: 710348-94-0，molecular formula: C12H15BFNO4），For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15BFNO4 |
|---|---|
| Molecular Weight | 267.06100 |
| Exact Mass | 267.10800 |
| PSA | 64.28000 |
| LogP | 2.55630 |
| InChIKey | CKBJFSWEKLWHTI-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cc(F)cc([N+](=O)[O-])c2)OC1(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:462652-01-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: SMILES notation of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is CC1(C)OB(c2cc(F)cc([N+](=O)[O-])c2)OC1(C)C. |
| Q: What is the polar surface area (PSA) of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: Polar surface area (PSA) of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is 64.28000. |
| Q: What is the molecular weight of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: Molecular weight of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is 267.06100. |
| Q: What is the InChIKey of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: InChIKey of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is CKBJFSWEKLWHTI-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: The English name of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane. |
| Q: What are the downstream products of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: Related downstream products(CAS) of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane: 462652-01-3. |
| Q: What is the LogP of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: LogP of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is 2.55630. |
| Q: What is the CAS number of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: CAS number of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is 710348-94-0. |
| Q: What is the molecular formula of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane? |
| A: Molecular formula of 2-(3-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is C12H15BFNO4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |