1,3-Benzodioxol-5-ol,6-nitro-, 5-acetate structure
|
Common Name | 1,3-Benzodioxol-5-ol,6-nitro-, 5-acetate | ||
|---|---|---|---|---|
| CAS Number | 7107-08-6 | Molecular Weight | 225.15500 | |
| Density | 1.5g/cm3 | Boiling Point | 363.4ºC at 760 mmHg | |
| Molecular Formula | C9H7NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
| Name | (6-nitro-1,3-benzodioxol-5-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 363.4ºC at 760 mmHg |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.15500 |
| Flash Point | 179.8ºC |
| Exact Mass | 225.02700 |
| PSA | 90.58000 |
| LogP | 1.77200 |
| Index of Refraction | 1.585 |
| InChIKey | DECGMUJJYLXRPA-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc2c(cc1[N+](=O)[O-])OCO2 |
|
~%
1,3-Benzodioxol... CAS#:7107-08-6 |
| Literature: Gertler et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 327 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1,3-benzodioxol-5-ol,6-nitro-,acetate(ester) |
| 3,4-methylenedioxy-6-nitrophenyl acetate |
| Essigsaeure-<6-nitro-3,4-methylendioxy-phenylester> |
| O-acetyl nitromethylenedioxyphenol |
| 5-Acetoxy-6-nitro-benzo[1,3]dioxol |
| 5-acetoxy-6-nitro-benzo[1,3]dioxole |