Ethyl 8-chloro-3-quinolinecarboxylate structure
|
Common Name | Ethyl 8-chloro-3-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 71083-19-7 | Molecular Weight | 235.666 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 341.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.6±22.3 °C | |
| Name | ethyl 8-chloroquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 341.9±22.0 °C at 760 mmHg |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.666 |
| Flash Point | 160.6±22.3 °C |
| Exact Mass | 235.040009 |
| PSA | 39.19000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | VCTDXHDHWDZBHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(Cl)cccc2c1 |
| HS Code | 2933499090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-chloroquinoline-3-carboxylic acid ethyl ester |
| Ethyl 8-chloro-3-quinolinecarboxylate |
| 3-Quinolinecarboxylic acid, 8-chloro-, ethyl ester |