N-[5-[[5-(2-cyanoethylcarbamoyl)-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-formamido-1-methylpyrrole-2-carboxamide structure
|
Common Name | N-[5-[[5-(2-cyanoethylcarbamoyl)-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-formamido-1-methylpyrrole-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 71084-59-8 | Molecular Weight | 464.47700 | |
| Density | 1.38g/cm3 | Boiling Point | 700.2ºC at 760 mmHg | |
| Molecular Formula | C22H24N8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 377.3ºC | |
| Name | N-[5-[[5-(2-cyanoethylcarbamoyl)-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-formamido-1-methylpyrrole-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 700.2ºC at 760 mmHg |
| Molecular Formula | C22H24N8O4 |
| Molecular Weight | 464.47700 |
| Flash Point | 377.3ºC |
| Exact Mass | 464.19200 |
| PSA | 158.47000 |
| LogP | 2.60488 |
| Index of Refraction | 1.669 |
| InChIKey | KKUCHUPZKHTIEJ-UHFFFAOYSA-N |
| SMILES | Cn1cc(NC(=O)c2cc(NC(=O)c3cc(NC=O)cn3C)cn2C)cc1C(=O)NCCC#N |
|
~88%
N-[5-[[5-(2-cya... CAS#:71084-59-8 |
| Literature: Beria, Italo; Baraldi, Pier Giovanni; Cozzi, Paolo; Caldarelli, Marina; Geroni, Cristina; Marchini, Sergio; Mongelli, Nicola; Romagnoli, Romeo Journal of Medicinal Chemistry, 2004 , vol. 47, # 10 p. 2611 - 2623 |
|
~%
N-[5-[[5-(2-cya... CAS#:71084-59-8 |
| Literature: NAXOSPHARMA S.R.L. Patent: WO2004/106301 A1, 2004 ; Location in patent: Page 15 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Cytotoxicity against African green monkey BSC1 cells after 24 to 72 hrs by light micr...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3254539
|
|
Name: Antiviral activity against Herpes simplex virus 1 HF infected in African green monkey...
Source: ChEMBL
Target: Human alphaherpesvirus 1
External Id: CHEMBL3254541
|
|
Name: Inhibition of Herpes simplex virus 1 HF DNA polymerase-mediated DNA synthesis in Afri...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3254957
|
|
Name: Inhibition of Herpes simplex virus 1 HF DNA polymerase-mediated DNA synthesis in Afri...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3254956
|
| N-(5,6-dimethylbenzothiazol-2-yl)salicylamide |
| N-(5,6-Dimethyl-2-benzothiazolyl)-2-hydroxybenzamide |
| Benzamide,N-(5,6-dimethyl-2-benzothiazolyl)-2-hydroxy |
| N-(5-{[(5-{[(2-cyanoethyl)amino]carbonyl}-1-methyl-1H-pyrrol-3-yl)amino]carbonyl}-1-methyl-1H-pyrrol-3-yl)-4-(formylamino)-1-methyl-1H-pyrrole-2-carboxamide |