2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide
Modify Date: 2026-06-29 10:22:01
2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide structure
|
Common Name | 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 710989-16-5 | Molecular Weight | 324.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClFN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14ClFN2OS |
|---|---|
| Molecular Weight | 324.8 |
| InChIKey | FOOASNWUXPWZOP-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=C(S2)NC(=O)CC3=C(C=CC=C3Cl)F |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: A High Throughput Screening Assay for Inhibitors of Bacterial Motility in Vibrio chol...
Source: Southern Research Institute
Target: N/A
External Id: CHOL_MOT
|
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 710989-16-5? |
| A: Chinese name of 710989-16-5 is 710989-16-5. |
| Q: What is the SMILES notation of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide? |
| A: SMILES notation of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide is C1CCC2=C(C1)N=C(S2)NC(=O)CC3=C(C=CC=C3Cl)F. |
| Q: What is the InChIKey of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide? |
| A: InChIKey of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide is FOOASNWUXPWZOP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide? |
| A: Molecular weight of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide is 324.8. |
| Q: What is the CAS number of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide? |
| A: CAS number of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide is 710989-16-5. |
| Q: What is the English name of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide? |
| A: The English name of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide is 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide. |
| Q: What is the molecular formula of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide? |
| A: Molecular formula of 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide is C15H14ClFN2OS. |