2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide structure
|
Common Name | 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 710989-16-5 | Molecular Weight | 324.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClFN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-chloro-6-fluorophenyl)-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
|---|
| Molecular Formula | C15H14ClFN2OS |
|---|---|
| Molecular Weight | 324.8 |
| InChIKey | FOOASNWUXPWZOP-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=C(S2)NC(=O)CC3=C(C=CC=C3Cl)F |
|
Name: A High Throughput Screening Assay for Inhibitors of Bacterial Motility in Vibrio chol...
Source: Southern Research Institute
Target: N/A
External Id: CHOL_MOT
|
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|