3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane structure
|
Common Name | 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane | ||
|---|---|---|---|---|
| CAS Number | 711-40-0 | Molecular Weight | 224.05100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6F8 |
|---|---|
| Molecular Weight | 224.05100 |
| Exact Mass | 223.98700 |
| LogP | 3.57180 |
| InChIKey | FUTRNCQHLGRBMN-UHFFFAOYSA-N |
| SMILES | FC(F)=C1C(=C(F)F)C(F)(F)C1(F)F |
|
~%
3,4-bis(difluor... CAS#:711-40-0 |
| Literature: Jacobs; Bauer Journal of the American Chemical Society, 1959 , vol. 81, p. 606,609 |
|
~%
3,4-bis(difluor... CAS#:711-40-0 |
| Literature: Banks,R.E. et al. Journal of the Chemical Society, 1965 , p. 978 - 990 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Octafluor-1,2-dimethylencyclobutan |
| Perfluor-(1,2-dimethylen-cyclobutan) |
| perfluoro-1,2-dimethylenecyclobutane |
| perfluoro-1,2-methylenecyclobutane |
| 1,2-Bis-difluormethylen-3,3,4,4-tetrafluor-cyclobutan |
| Cyclobutane,1,2-bis(difluoromethylene)-3,3,4,4-tetrafluoro |
| 1,2-bis-difluoromethylene-3,3,4,4-tetrafluoro-cyclobutane |
| octafluoro-1,2-dimethylenecyclobutane |