3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane
3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane structure
|
Common Name | 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane | ||
|---|---|---|---|---|
| CAS Number | 711-40-0 | Molecular Weight | 224.05100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,4-Bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane (CAS: 711-40-0, molecular formula: C6F8, molecular weight: 224.05100), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6F8 |
|---|---|
| Molecular Weight | 224.05100 |
| Exact Mass | 223.98700 |
| LogP | 3.57180 |
| InChIKey | FUTRNCQHLGRBMN-UHFFFAOYSA-N |
| SMILES | FC(F)=C1C(=C(F)F)C(F)(F)C1(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,4-bis(difluor... CAS#:711-40-0 |
| Literature: Jacobs; Bauer Journal of the American Chemical Society, 1959 , vol. 81, p. 606,609 |
|
~%
3,4-bis(difluor... CAS#:711-40-0 |
| Literature: Banks,R.E. et al. Journal of the Chemical Society, 1965 , p. 978 - 990 |
![1,2-Bis-[chlordifluor-methyl]-tetrafluor-cyclobuten structure](https://image.chemsrc.com/caspic/097/781-12-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:377-38-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Octafluor-1,2-dimethylencyclobutan |
| Perfluor-(1,2-dimethylen-cyclobutan) |
| perfluoro-1,2-dimethylenecyclobutane |
| perfluoro-1,2-methylenecyclobutane |
| 1,2-Bis-difluormethylen-3,3,4,4-tetrafluor-cyclobutan |
| Cyclobutane,1,2-bis(difluoromethylene)-3,3,4,4-tetrafluoro |
| 1,2-bis-difluoromethylene-3,3,4,4-tetrafluoro-cyclobutane |
| octafluoro-1,2-dimethylenecyclobutane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: SMILES notation of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane is FC(F)=C1C(=C(F)F)C(F)(F)C1(F)F. |
| Q: What is the CAS number of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: CAS number of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane is 711-40-0. |
| Q: What is the Chinese name of 711-40-0? |
| A: Chinese name of 711-40-0 is 711-40-0. |
| Q: What English synonyms does 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane have? |
| A: English synonyms of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane: Octafluor-1,2-dimethylencyclobutan, Perfluor-(1,2-dimethylen-cyclobutan), perfluoro-1,2-dimethylenecyclobutane, perfluoro-1,2-methylenecyclobutane, 1,2-Bis-difluormethylen-3,3,4,4-tetrafluor-cyclobutan, Cyclobutane,1,2-bis(difluoromethylene)-3,3,4,4-tetrafluoro, 1,2-bis-difluoromethylene-3,3,4,4-tetrafluoro-cyclobutane, octafluoro-1,2-dimethylenecyclobutane. |
| Q: What are the upstream materials of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: Related upstream materials(CAS) of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane: 461-68-7;781-12-4. |
| Q: What is the LogP of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: LogP of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane is 3.57180. |
| Q: What is the molecular formula of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: Molecular formula of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane is C6F8. |
| Q: What is the English name of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: The English name of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane is 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane. |
| Q: What is the InChIKey of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: InChIKey of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane is FUTRNCQHLGRBMN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane? |
| A: Molecular weight of 3,4-bis(difluoromethylidene)-1,1,2,2-tetrafluorocyclobutane is 224.05100. |