1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole
![1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole Structure](https://image.chemsrc.com/caspic/252/711-53-5.png)
1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole structure
|
Common Name | 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole | ||
|---|---|---|---|---|
| CAS Number | 711-53-5 | Molecular Weight | 206.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name is 1,1-二氟-1,2-二氢萘[1,8-bc]硅醇, the English name is 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole, and the CAS number is 711-53-5. The molecular formula is C11H8F2Si, and the molecular weight is 206.26400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8F2Si |
|---|---|
| Molecular Weight | 206.26400 |
| Exact Mass | 206.03600 |
| LogP | 2.78970 |
| InChIKey | DQQXIFPEWKSAJK-UHFFFAOYSA-N |
| SMILES | F[Si]1(F)Cc2cccc3cccc1c23 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1-difluoro-1,... CAS#:711-53-5 |
| Literature: Chernyshev,E.A.; Tolstikova,N.G. J. Gen. Chem. USSR (Engl. Transl.), 1970 , vol. 40, # 5 p. 1052 - 1058,1039 - 1044 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Silaacenaphthylene,1,1-difluoro-1,2-dihydro |
| 1,1-Difluor-1-silaacenaphthen |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: The English name of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole is 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole. |
| Q: What is the CAS number of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: CAS number of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole is 711-53-5. |
| Q: What are the upstream materials of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: Related upstream materials(CAS) of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole: 13093-11-3. |
| Q: What is the InChIKey of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: InChIKey of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole is DQQXIFPEWKSAJK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 711-53-5? |
| A: Chinese name of 711-53-5 is 711-53-5. |
| Q: What is the molecular weight of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: Molecular weight of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole is 206.26400. |
| Q: What is the molecular formula of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: Molecular formula of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole is C11H8F2Si. |
| Q: What is the LogP of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: LogP of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole is 2.78970. |
| Q: What is the SMILES notation of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole? |
| A: SMILES notation of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole is F[Si]1(F)Cc2cccc3cccc1c23. |
| Q: What English synonyms does 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole have? |
| A: English synonyms of 1,1-difluoro-1,2-dihydro-naphtho[1,8-bc]silole: 1-Silaacenaphthylene,1,1-difluoro-1,2-dihydro, 1,1-Difluor-1-silaacenaphthen. |