acetic acid,4-(bromomethyl)-2,6-dimethylphenol structure
|
Common Name | acetic acid,4-(bromomethyl)-2,6-dimethylphenol | ||
|---|---|---|---|---|
| CAS Number | 711-95-5 | Molecular Weight | 257.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,4-(bromomethyl)-2,6-dimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13BrO2 |
|---|---|
| Molecular Weight | 257.12 |
| Exact Mass | 256.00989 |
| PSA | 57.53000 |
| LogP | 2.99480 |
| InChIKey | JARMUKWSAYQPKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC(=O)C)C)CBr |
| HS Code | 2915390090 |
|---|
|
~78%
acetic acid,4-(... CAS#:711-95-5 |
| Literature: ABBOTT LABORATORIES Patent: US2011/144165 A1, 2011 ; Location in patent: Page/Page column 25 ; |
|
~%
acetic acid,4-(... CAS#:711-95-5 |
| Literature: Fries; Brandes Justus Liebigs Annalen der Chemie, 1939 , vol. 542, p. 48,63 |
|
~%
acetic acid,4-(... CAS#:711-95-5 |
| Literature: Fries; Brandes Justus Liebigs Annalen der Chemie, 1939 , vol. 542, p. 48,63 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 4-Acetoxy-3.5-dimethyl-1-brommethyl-benzol |
| Phenol,4-(bromomethyl)-2,6-dimethyl-,acetate |
| acetic acid-(4-bromomethyl-2,6-dimethyl-phenyl ester) |
| 4-(bromomethyl)-2,6-dimethylphenyl acetate |
| (2.6-Dimethyl-4-brommethyl-phenyl)-acetat |
| 4-Brommethyl-2,6-dimethyl-phenylacetat |
| Essigsaeure-(4-brommethyl-2,6-dimethyl-phenylester) |
| 3,5-dimethyl-4-acetoxy-benzylbromide |