4-(dimethoxymethyl)-2-methoxy-1-phenylmethoxybenzene structure
|
Common Name | 4-(dimethoxymethyl)-2-methoxy-1-phenylmethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 71146-61-7 | Molecular Weight | 288.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(dimethoxymethyl)-2-methoxy-1-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20O4 |
|---|---|
| Molecular Weight | 288.33800 |
| Exact Mass | 288.13600 |
| PSA | 36.92000 |
| LogP | 3.56560 |
| InChIKey | RBZJOEWWFQWOSC-UHFFFAOYSA-N |
| SMILES | COc1cc(C(OC)OC)ccc1OCc1ccccc1 |
|
~%
4-(dimethoxymet... CAS#:71146-61-7 |
| Literature: Barrett,A.G.M. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 652 - 661 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzylvanillin-dimethylacetal |
| Benzene,4-(dimethoxymethyl)-2-methoxy-1-(phenylmethoxy) |