1,3-Benzodioxole-5-propanoic acid, ethyl ester structure
|
Common Name | 1,3-Benzodioxole-5-propanoic acid, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7116-48-5 | Molecular Weight | 222.23700 | |
| Density | 1.192g/cm3 | Boiling Point | 311.5ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.3ºC | |
| Name | ethyl 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 311.5ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 135.3ºC |
| Exact Mass | 222.08900 |
| PSA | 44.76000 |
| LogP | 1.91100 |
| Index of Refraction | 1.53 |
| InChIKey | SHFDGDJEJOHKSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1ccc2c(c1)OCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Benzodioxole-5-propanoic acid,ethyl ester |
| Ethyl homopiperonylacetate |
| ethyl 1,3-benzodioxole-5-propionate |