isophthalic acid, compound with dimethylamine (1:1) structure
|
Common Name | isophthalic acid, compound with dimethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71172-17-3 | Molecular Weight | 211.21500 | |
| Density | N/A | Boiling Point | 412.3ºC at 760mmHg | |
| Molecular Formula | C10H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | benzene-1,3-dicarboxylic acid,N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 412.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.21500 |
| Flash Point | 217.3ºC |
| Exact Mass | 211.08400 |
| PSA | 86.63000 |
| LogP | 1.30950 |
| InChIKey | PSXFWDBXOBHGSA-UHFFFAOYSA-N |
| SMILES | CNC.O=C(O)c1cccc(C(=O)O)c1 |
| EINECS 275-226-8 |
| 1,3-benzenedicarboxylic acid,compd. with n-methylmethanamine(1:1) |
| Dimethylammonium hydrogen isophthalate |