1-(5-fluoro-1H-indol-3-yl)propan-2-amine structure
|
Common Name | 1-(5-fluoro-1H-indol-3-yl)propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 712-08-3 | Molecular Weight | 192.23300 | |
| Density | 1.205g/cm3 | Boiling Point | 348ºC at 760 mmHg | |
| Molecular Formula | C11H13FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | 1-(5-fluoro-1H-indol-3-yl)propan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 348ºC at 760 mmHg |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.23300 |
| Flash Point | 164.3ºC |
| Exact Mass | 192.10600 |
| PSA | 41.81000 |
| LogP | 2.89700 |
| Index of Refraction | 1.622 |
| InChIKey | CTGFDWBZMCPVED-UHFFFAOYSA-N |
| SMILES | CC(N)Cc1c[nH]c2ccc(F)cc12 |
| HS Code | 2933990090 |
|---|
|
~%
1-(5-fluoro-1H-... CAS#:712-08-3 |
| Literature: Marshall, Daniel R.; Rodriguez, Gus; Thomson, David S.; Nelson, Richard; Capolina, Allison Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 2 p. 315 - 319 |
|
~%
1-(5-fluoro-1H-... CAS#:712-08-3 |
| Literature: Marshall, Daniel R.; Rodriguez, Gus; Thomson, David S.; Nelson, Richard; Capolina, Allison Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 2 p. 315 - 319 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(5-fluoro-indol-3-yl)-1-methyl-ethylamine |
| 5-fluoro-A-methyltryptamine |
| 3-(2-Amino-propyl)-5-fluor-indol |
| 5-Fluor-3-(2-amino-propyl)-indol |
| 3-(2-Aminopropyl)-5-fluoroindole |
| INDOLE,3-(2-AMINOPROPYL)-5-FLUORO |