ethyl 2-methylquinoline-4-carboxylate structure
|
Common Name | ethyl 2-methylquinoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7120-26-5 | Molecular Weight | 215.24800 | |
| Density | 1.148 | Boiling Point | 329.3ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-methylquinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148 |
|---|---|
| Boiling Point | 329.3ºC at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Exact Mass | 215.09500 |
| PSA | 39.19000 |
| LogP | 2.71990 |
| Index of Refraction | 1.591 |
| InChIKey | QLDHESIQYKWVIL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C)nc2ccccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methyl-quinoline-4-carboxylic acid ethyl ester |
| 2-Methyl-chinolin-4-carbonsaeure-aethylester |
| 2-Methylcincholinsaeure-ethylester |