1-ethyl-2-methylbenzo[e][1,3]benzothiazol-1-ium,iodide structure
|
Common Name | 1-ethyl-2-methylbenzo[e][1,3]benzothiazol-1-ium,iodide | ||
|---|---|---|---|---|
| CAS Number | 71205-40-8 | Molecular Weight | 355.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14INS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-2-methylbenzo[e][1,3]benzothiazol-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14INS |
|---|---|
| Molecular Weight | 355.23700 |
| Exact Mass | 354.98900 |
| PSA | 32.12000 |
| LogP | 0.67430 |
| InChIKey | IPKTZUFBDABYFP-UHFFFAOYSA-M |
| SMILES | CC[n+]1c(C)sc2ccc3ccccc3c21.[I-] |
|
~%
1-ethyl-2-methy... CAS#:71205-40-8 |
| Literature: Hamer Journal of the Chemical Society, 1929 , p. 2604 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Naphtho(1,2-d)thiazolium,1-ethyl-2-methyl-,iodide |
| 1-Aethyl-2-methyl-naphtho[1,2-d]thiazolium,Jodid |
| 1-ethyl-2-methyl-naphtho[1,2-d]thiazolium,iodide |
| N-Ethyl-2-methyl-naphtho<1,2-d>thiazolium-iodid |
| Naphtho(1,2-d)thiazolium,1-ethyl-2-methyl-,iodide (1:1) |
| 1-ethyl-2-methylbenzo[e][1,3]benzothiazol-1-ium iodide |