ethyl N-[4-[3-(methylcarbamoyl)thiazolidin-2-yl]phenyl]carbamate structure
|
Common Name | ethyl N-[4-[3-(methylcarbamoyl)thiazolidin-2-yl]phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 71207-61-9 | Molecular Weight | 309.38400 | |
| Density | 1.291g/cm3 | Boiling Point | 479.6ºC at 760 mmHg | |
| Molecular Formula | C14H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.9ºC | |
| Name | ethyl N-[4-[3-(methylcarbamoyl)-1,3-thiazolidin-2-yl]phenyl]carbamate |
|---|
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 479.6ºC at 760 mmHg |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.38400 |
| Flash Point | 243.9ºC |
| Exact Mass | 309.11500 |
| PSA | 95.97000 |
| LogP | 3.04360 |
| Index of Refraction | 1.613 |
| InChIKey | RBOQTIXZLLUCGP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(C2SCCN2C(=O)NC)cc1 |
|
~88%
ethyl N-[4-[3-(... CAS#:71207-61-9 |
| Literature: Witek, Stanislaw; Bielawska, Alicja; Bielawski, Jacek Polish Journal of Chemistry, 1981 , vol. 55, # 5 p. 1043 - 1048 |
|
~%
ethyl N-[4-[3-(... CAS#:71207-61-9 |
| Literature: Witek, Stanislaw; Bielawska, Alicja; Bielawski, Jacek Polish Journal of Chemistry, 1981 , vol. 55, # 5 p. 1043 - 1048 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |