2H-Pyrimido[4,5-d][1,3]thiazine-5,7(1H,6H)-dione,4,8-dihydro-6,8-dimethyl-2,4-dithioxo- structure
|
Common Name | 2H-Pyrimido[4,5-d][1,3]thiazine-5,7(1H,6H)-dione,4,8-dihydro-6,8-dimethyl-2,4-dithioxo- | ||
|---|---|---|---|---|
| CAS Number | 71266-56-3 | Molecular Weight | 273.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8-dimethyl-2,4-bis(sulfanylidene)-1H-pyrimido[4,5-d][1,3]thiazine-5,7-dione |
|---|
| Molecular Formula | C8H7N3O2S3 |
|---|---|
| Molecular Weight | 273.35500 |
| Exact Mass | 272.97000 |
| PSA | 152.21000 |
| LogP | 1.08580 |
| InChIKey | GTMWCSIBGAXJMT-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(=S)sc(=S)[nH]c2n(C)c1=O |
|
~%
2H-Pyrimido[4,5... CAS#:71266-56-3 |
| Literature: Tominaga; Machida; Okuda; Matsuda; Kobayashi Yakugaku zasshi : Journal of the Pharmaceutical Society of Japan, 1979 , vol. 99, # 5 p. 515 - 520 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |