(9,10-dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-8-ylidene)-phenyl-amine structure
|
Common Name | (9,10-dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-8-ylidene)-phenyl-amine | ||
|---|---|---|---|---|
| CAS Number | 71266-73-4 | Molecular Weight | 426.46400 | |
| Density | 1.33g/cm3 | Boiling Point | 627.9ºC at 760 mmHg | |
| Molecular Formula | C26H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.6ºC | |
| Name | (9,10-dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-8-ylidene)-phenyl-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 627.9ºC at 760 mmHg |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.46400 |
| Flash Point | 333.6ºC |
| Exact Mass | 426.15800 |
| PSA | 54.21000 |
| LogP | 4.84270 |
| Index of Refraction | 1.669 |
| InChIKey | ACZPSGGVLFZZRJ-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc3n(c(=Nc4ccccc4)c2c1OC)CCc1cc2c(cc1-3)OCO2 |
|
~%
(9,10-dimethoxy... CAS#:71266-73-4 |
| Literature: Moniot; Kravetz; El Rahman Abd El Rahman; Shamma Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 6 p. 705 - 708 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8-Berberinylidenanilin |