(S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester
Modify Date: 2026-07-01 10:54:05
(S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester structure
|
Common Name | (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 71283-66-4 | Molecular Weight | 258.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14O5S |
|---|---|
| Molecular Weight | 258.29100 |
| Exact Mass | 258.05600 |
| PSA | 78.05000 |
| LogP | 2.34260 |
| InChIKey | ATFXADBXZLGFJY-VIFPVBQESA-N |
| SMILES | COC(=O)C(C)OS(=O)(=O)c1ccc(C)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| METHYL (R)-2-TOSYLOXY PROPIONATE |
| methyl (E)-2-(2-(bromomethyl)-phenyl)-3-methoxy-2-acrylate |
| (-)-(S)-Methyl 2-[(p-tolylsulfonyl)oxy]propionate |
| (2S)-2-(4-methylphenylsulfonyloxy)-propanoic acid methyl ester |
| methyl (S)-O-toluenesulfonyl lactate |
| methyl O-(p-toluenesulfonyl)-(S)-(-)-lactate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: InChIKey of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is ATFXADBXZLGFJY-VIFPVBQESA-N. |
| Q: What is the Chinese name of 71283-66-4? |
| A: Chinese name of 71283-66-4 is 71283-66-4. |
| Q: What is the molecular weight of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: Molecular weight of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is 258.29100. |
| Q: What is the polar surface area (PSA) of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: Polar surface area (PSA) of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is 78.05000. |
| Q: What is the LogP of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: LogP of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is 2.34260. |
| Q: What is the molecular formula of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: Molecular formula of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is C11H14O5S. |
| Q: What is the CAS number of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: CAS number of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is 71283-66-4. |
| Q: What is the English name of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: The English name of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester. |
| Q: What English synonyms does (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester have? |
| A: English synonyms of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester: METHYL (R)-2-TOSYLOXY PROPIONATE, methyl (E)-2-(2-(bromomethyl)-phenyl)-3-methoxy-2-acrylate, (-)-(S)-Methyl 2-[(p-tolylsulfonyl)oxy]propionate, (2S)-2-(4-methylphenylsulfonyloxy)-propanoic acid methyl ester, methyl (S)-O-toluenesulfonyl lactate, methyl O-(p-toluenesulfonyl)-(S)-(-)-lactate. |
| Q: What is the SMILES notation of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester? |
| A: SMILES notation of (S)-2-(toluene-4-sulfonyloxy)-propionic acid methyl ester is COC(=O)C(C)OS(=O)(=O)c1ccc(C)cc1. |