AKOS B029240
Modify Date: 2024-01-01 18:37:43
AKOS B029240 structure
|
Common Name | AKOS B029240 | ||
|---|---|---|---|---|
| CAS Number | 713104-07-5 | Molecular Weight | 244.67200 | |
| Density | 1.252g/cm3 | Boiling Point | 346.3ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | 2-chloro-5-methoxy-4-propan-2-yloxybenzoic acid |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 346.3ºC at 760 mmHg |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67200 |
| Flash Point | 163.2ºC |
| Exact Mass | 244.05000 |
| PSA | 55.76000 |
| LogP | 2.83400 |
| Index of Refraction | 1.533 |
| InChIKey | SJDKPTLZBDUBFM-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(Cl)cc1OC(C)C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |