3-(4-CHLOROPHENYL)-2H-BENZO[E][1,3]OXAZINE-2,4(3H)-DIONE
![3-(4-CHLOROPHENYL)-2H-BENZO[E][1,3]OXAZINE-2,4(3H)-DIONE Structure](https://image.chemsrc.com/caspic/140/7133-85-9.png)
3-(4-CHLOROPHENYL)-2H-BENZO[E][1,3]OXAZINE-2,4(3H)-DIONE structure
|
Common Name | 3-(4-CHLOROPHENYL)-2H-BENZO[E][1,3]OXAZINE-2,4(3H)-DIONE | ||
|---|---|---|---|---|
| CAS Number | 7133-85-9 | Molecular Weight | 273.67100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8ClNO3 |
|---|---|
| Molecular Weight | 273.67100 |
| Exact Mass | 273.01900 |
| PSA | 52.21000 |
| LogP | 2.59730 |
| InChIKey | NQVADDMGQVZJHU-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![4-[N-[N-(4-chlorophenyl)carbamoyl]imino]-3-(4-chlorophenyl)-2H-1,3-benzoxazin-2-one structure](https://image.chemsrc.com/caspic/432/88220-42-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(4-chlorophenyl)-2H-1,3-benzoxazine-2,4(3H)-dione |
| 3-(4-Chlorphenyl)-1,3-benzoxazindion-2,4 |
| 3-(p-chlorophenyl)benzo[e]-1,3-oxazine-2,4-dione |
| 3-(4-Chlor-phenyl)-2,4-dioxo-3,4-dihydro-2H-1.3-benzoxazin |
| 2H-1,3-Benzoxazine-2,4(3H)-dione,3-(4-chlorophenyl) |
| 3-(4-chloro-phenyl)-benzo[e][1,3]oxazine-2,4-dione |
| 3-(4-Chlrophenyl)-2H-1,3-benzoxazine-2,4(3H)-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: Molecular weight of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione is 273.67100. |
| Q: What is the polar surface area (PSA) of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: Polar surface area (PSA) of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione is 52.21000. |
| Q: What is the molecular formula of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: Molecular formula of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione is C14H8ClNO3. |
| Q: What English synonyms does 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione have? |
| A: English synonyms of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione: 3-(4-chlorophenyl)-2H-1,3-benzoxazine-2,4(3H)-dione, 3-(4-Chlorphenyl)-1,3-benzoxazindion-2,4, 3-(p-chlorophenyl)benzo[e]-1,3-oxazine-2,4-dione, 3-(4-Chlor-phenyl)-2,4-dioxo-3,4-dihydro-2H-1.3-benzoxazin, 2H-1,3-Benzoxazine-2,4(3H)-dione,3-(4-chlorophenyl), 3-(4-chloro-phenyl)-benzo[e][1,3]oxazine-2,4-dione, 3-(4-Chlrophenyl)-2H-1,3-benzoxazine-2,4(3H)-dione. |
| Q: What is the Chinese name of 7133-85-9? |
| A: Chinese name of 7133-85-9 is 7133-85-9. |
| Q: What is the SMILES notation of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: SMILES notation of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione is O=c1oc2ccccc2c(=O)n1-c1ccc(Cl)cc1. |
| Q: What is the English name of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: The English name of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione is 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione. |
| Q: What is the InChIKey of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: InChIKey of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione is NQVADDMGQVZJHU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: CAS number of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione is 7133-85-9. |
| Q: What are the upstream materials of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione? |
| A: Related upstream materials(CAS) of 3-(4-chlorophenyl)-1,3-benzoxazine-2,4-dione: 533-58-4;201230-82-2;104-12-1;88220-42-2;3679-63-8;541-41-3;611-20-1;88220-36-4;108-23-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |