[4-[4-(4-pentanoyloxyphenyl)buta-1,3-diynyl]phenyl] pentanoate structure
|
Common Name | [4-[4-(4-pentanoyloxyphenyl)buta-1,3-diynyl]phenyl] pentanoate | ||
|---|---|---|---|---|
| CAS Number | 71332-83-7 | Molecular Weight | 402.48200 | |
| Density | 1.15g/cm3 | Boiling Point | 530.3ºC at 760 mmHg | |
| Molecular Formula | C26H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.3ºC | |
| Name | [4-[4-(4-pentanoyloxyphenyl)buta-1,3-diynyl]phenyl] pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 530.3ºC at 760 mmHg |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.48200 |
| Flash Point | 262.3ºC |
| Exact Mass | 402.18300 |
| PSA | 52.60000 |
| LogP | 5.28100 |
| Index of Refraction | 1.577 |
| InChIKey | OVPLFIJMKWNQRE-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)Oc1ccc(C#CC#Cc2ccc(OC(=O)CCCC)cc2)cc1 |
|
~%
[4-[4-(4-pentan... CAS#:71332-83-7 |
| Literature: Ozcayir, Y.; Asrar, J.; Blumstein, A. Molecular Crystals and Liquid Crystals (1969-1991), 1984 , vol. 110, p. 263 - 276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-Di-n-pentanoyloxydiphenyldiacetylen |
| buta-1,3-diyne-1,4-diyldibenzene-4,1-diyl dipentanoate |
| 4,4'-Dipentanoyloxydiphenyldiacetylene |