1-bromo-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one structure
|
Common Name | 1-bromo-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 71347-30-3 | Molecular Weight | 246.10400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H12BrN3O |
|---|---|
| Molecular Weight | 246.10400 |
| Exact Mass | 245.01600 |
| PSA | 47.78000 |
| LogP | 1.78680 |
| InChIKey | KIVDZERHEZTUGL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(Br)n1cncn1 |
|
~%
1-bromo-3,3-dim... CAS#:71347-30-3 |
| Literature: Chen, Wen-Bin; Jin, Gui-Yu Phosphorus, Sulfur and Silicon and the Related Elements, 2003 , vol. 178, # 2 p. 311 - 317 |
|
~%
1-bromo-3,3-dim... CAS#:71347-30-3 |
| Literature: Bayer Aktiengesellschaft Patent: US4739119 A1, 1988 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Butanone,1-bromo-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl) |
| 1-bromo-3,3-dimethyl-1-(1,2,4-triazol-1-yl)-butan-2-one |
| 1-bromo-3,3-dimethyl-1-(1,2,4-triazol-1-yl)-2-butanone |
| 3,3-dimethyl-1-bromo-1-(1H-1,2,4-triazolo-1-yl)-2-butanone |
| 1-bromo(1,2,4-triazol-1-yl)-3,3-dimethyl-butan-2-one |