[3-iodo-5-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methanol structure
|
Common Name | [3-iodo-5-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 713497-17-7 | Molecular Weight | 342.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F3IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-iodo-5-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6F3IN2O |
|---|---|
| Molecular Weight | 342.05600 |
| Exact Mass | 341.94800 |
| PSA | 44.95000 |
| LogP | 1.83560 |
| InChIKey | PSIQIKVXWDNGRW-UHFFFAOYSA-N |
| SMILES | OCc1cc(I)cc(C2(C(F)(F)F)N=N2)c1 |
|
~%
[3-iodo-5-[3-(t... CAS#:713497-17-7 |
| Literature: Gallant, Michel; Sawyer, Nicole; Metters, Kathleen M.; Zamboni, Robert J. Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 1 p. 63 - 72 |
|
~%
[3-iodo-5-[3-(t... CAS#:713497-17-7 |
| Literature: Gallant, Michel; Sawyer, Nicole; Metters, Kathleen M.; Zamboni, Robert J. Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 1 p. 63 - 72 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenemethanol,3-iodo-5-[3-(trifluoromethyl)-3H-diazirin-3-yl] |
| 3-iodo-5-(3-(trifluoromethyl)-3H-diazirine-3-yl)benzyl alcohol |
| 3-[3-iodo-5-(hydroxymethyl)phenyl]-3-trifluoromethyl-3H-diazirine |